CAS 64050-77-7 appears in our catalog under these names: Neostigmine Impurity 13 Metilsulfate, Neostigmine Impurity 21, N,N,N-Trimethyl-3-(((methylamino)carbonyl)oxy)-Benzenaminium Methyl Sulfate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Methyl sulfate;trimethyl-[3-(methylcarbamoyloxy)phenyl]azanium (CAS 64050-77-7) is a chemical compound with the molecular formula C12H20N2O6S and a molecular weight of 320.36 g/mol. IUPAC name: methyl sulfate;trimethyl-[3-(methylcarbamoyloxy)phenyl]azanium. InChIKey: RLOBKDKQCFKARS-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O6S |
|---|---|
| Molecular weight | 320.36 g/mol |
| IUPAC name | methyl sulfate;trimethyl-[3-(methylcarbamoyloxy)phenyl]azanium |
| InChIKey | RLOBKDKQCFKARS-UHFFFAOYSA-N |
| SMILES | CNC(=O)OC1=CC=CC(=C1)[N+](C)(C)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)