Products 6406-56-0
CAS 6406-56-0 is the registry number for C.I. Acid red 151. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 4-[[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate (CAS 6406-56-0) is a chemical compound with the molecular formula C22H15N4NaO4S and a molecular weight of 454.4 g/mol. IUPAC name: sodium 4-[[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate. InChIKey: QERXHBDEEFLTOL-UHFFFAOYSA-M.
| Molecular formula | C22H15N4NaO4S |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | sodium 4-[[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate |
| InChIKey | QERXHBDEEFLTOL-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N=NC3=CC=C(C=C3)N=NC4=CC=C(C=C4)S(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)