CAS 640735-25-7 appears in our catalog under these names: 4-FLUORO-1-(TRIISOPROPYLSILANYL)-7-AZAINDOLE, 97%, 4-Fluoro-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine, 97%, 97%, 4-Fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (CAS 640735-25-7) is a chemical compound with the molecular formula C16H25FN2Si and a molecular weight of 292.47 g/mol. IUPAC name: (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane. InChIKey: YESANHMKGXGZLQ-UHFFFAOYSA-N.
| Molecular formula | C16H25FN2Si |
|---|---|
| Molecular weight | 292.47 g/mol |
| IUPAC name | (4-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| InChIKey | YESANHMKGXGZLQ-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C=CN=C21)F |
Computed by PubChem (NCBI)