CAS 64096-91-9 appears in our catalog under these names: 4H-Benzo[4,5]imidazo[1,2-b]pyrazole-3-carbonitrile, 95%, 4H–Benzo(4,5)imidazo(1,2–b)pyrazole–3–carbonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1H-pyrazolo[1,5-a]benzimidazole-3-carbonitrile (CAS 64096-91-9) is a chemical compound with the molecular formula C10H6N4 and a molecular weight of 182.18 g/mol. IUPAC name: 1H-pyrazolo[1,5-a]benzimidazole-3-carbonitrile. InChIKey: AQFUNDWLSQYOOR-UHFFFAOYSA-N.
| Molecular formula | C10H6N4 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 1H-pyrazolo[1,5-a]benzimidazole-3-carbonitrile |
| InChIKey | AQFUNDWLSQYOOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2NC=C3C#N |
Computed by PubChem (NCBI)