CAS 641-49-6 appears in our catalog under these names: 1-Fluoro-3-methoxy-2-nitrobenzene, 3-Fluoro-2-nitroanisole 98%, 3-Fluoro-2-nitroanisole, 95%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 10g, 50g, 250mg, 1g, 5g, 100g, 500g.
1-fluoro-3-methoxy-2-nitrobenzene (CAS 641-49-6) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 1-fluoro-3-methoxy-2-nitrobenzene. InChIKey: GMWOSSBFNSZKAH-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 1-fluoro-3-methoxy-2-nitrobenzene |
| InChIKey | GMWOSSBFNSZKAH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)