CAS 64118-81-6 appears in our catalog under these names: Diclofenac-acyl-beta-D-glucuronide, Diclofenac Impurity 20, Diclofenac Acyl-beta-D-glucuronide, >95% (HPLC), Diclofenac Acyl Glucuronide/ 95%, Diclofenac Acyl–β–D–Glucuronide. Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(2S,3S,4S,5R,6S)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 64118-81-6) is a chemical compound with the molecular formula C20H19Cl2NO8 and a molecular weight of 472.3 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: JXIKYYSIYCILNG-HBWRTXEVSA-N.
| Molecular formula | C20H19Cl2NO8 |
|---|---|
| Molecular weight | 472.3 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | JXIKYYSIYCILNG-HBWRTXEVSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O)NC3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)