Products 64118-83-8

CAS 64118-83-8 is the registry number for 4’-Hydroxy Diclofenac Sulfate. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2-[2-(2,6-dichloro-4-sulfooxyanilino)phenyl]acetic acid (CAS 64118-83-8) is a chemical compound with the molecular formula C14H11Cl2NO6S and a molecular weight of 392.2 g/mol. IUPAC name: 2-[2-(2,6-dichloro-4-sulfooxyanilino)phenyl]acetic acid. InChIKey: VMRXAZSKKNZVAC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO6S
Molecular weight392.2 g/mol
IUPAC name2-[2-(2,6-dichloro-4-sulfooxyanilino)phenyl]acetic acid
InChIKeyVMRXAZSKKNZVAC-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CC(=O)O)NC2=C(C=C(C=C2Cl)OS(=O)(=O)O)Cl

Computed by PubChem (NCBI)