Products 64124-29-4

CAS 64124-29-4 is the registry number for Trans-4-guanidinocyclohexanecarboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-(diaminomethylideneamino)cyclohexane-1-carboxylic acid (CAS 64124-29-4) is a chemical compound with the molecular formula C8H15N3O2 and a molecular weight of 185.22 g/mol. IUPAC name: 4-(diaminomethylideneamino)cyclohexane-1-carboxylic acid. InChIKey: HKNFSQIYNOWVFO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15N3O2
Molecular weight185.22 g/mol
IUPAC name4-(diaminomethylideneamino)cyclohexane-1-carboxylic acid
InChIKeyHKNFSQIYNOWVFO-UHFFFAOYSA-N
SMILESC1CC(CCC1C(=O)O)N=C(N)N

Computed by PubChem (NCBI)