CAS 64145-28-4 appears in our catalog under these names: 2'-Deoxyadenosine5'-O-(1-thiotriphosphate), 98%, dATPαS. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate (CAS 64145-28-4) is a chemical compound with the molecular formula C10H16N5O11P3S and a molecular weight of 507.25 g/mol. IUPAC name: [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate. InChIKey: CCPIKNHZOWQALM-DLQJRSQOSA-N.
| Molecular formula | C10H16N5O11P3S |
|---|---|
| Molecular weight | 507.25 g/mol |
| IUPAC name | [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
| InChIKey | CCPIKNHZOWQALM-DLQJRSQOSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=S)(O)OP(=O)(O)OP(=O)(O)O)O |
Computed by PubChem (NCBI)