CAS 64145-29-5 appears in our catalog under these names: 2'-Deoxycytidine-5'-O-(1-thiotriphosphate), 95%, 2'-Deoxycytidine-5'-O-(1-thiotriphosphate) sodium salt - 10 mM aqueous solution, dCTPαS. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 2mg, 1mg, 5mg, 1000mg, Get quote.
[[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate (CAS 64145-29-5) is a chemical compound with the molecular formula C9H16N3O12P3S and a molecular weight of 483.23 g/mol. IUPAC name: [[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate. InChIKey: CBYOGVVSAABFCZ-JURLQNGUSA-N.
| Molecular formula | C9H16N3O12P3S |
|---|---|
| Molecular weight | 483.23 g/mol |
| IUPAC name | [[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
| InChIKey | CBYOGVVSAABFCZ-JURLQNGUSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)COP(=S)(O)OP(=O)(O)OP(=O)(O)O)O |
Computed by PubChem (NCBI)