CAS 64150-61-4 is the registry number for 2,3–Dibromobenzofuran. Offered by: GLPBio. Available pack sizes: 1g.
2,3-dibromo-1-benzofuran (CAS 64150-61-4) is a chemical compound with the molecular formula C8H4Br2O and a molecular weight of 275.92 g/mol. IUPAC name: 2,3-dibromo-1-benzofuran. InChIKey: JPYBOGFQEPDJRZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2O |
|---|---|
| Molecular weight | 275.92 g/mol |
| IUPAC name | 2,3-dibromo-1-benzofuran |
| InChIKey | JPYBOGFQEPDJRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(O2)Br)Br |
Computed by PubChem (NCBI)