CAS 641571-14-4 is the registry number for 1,1-Dimethylethyl N-(3-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl)carbamate. Offered by: Mikromol. Available pack sizes: 25mg.
Tert-butyl N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]carbamate (CAS 641571-14-4) is a chemical compound with the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. IUPAC name: tert-butyl N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]carbamate. InChIKey: XSSQAAHBIVFYGC-UHFFFAOYSA-N.
| Molecular formula | C16H18F3N3O2 |
|---|---|
| Molecular weight | 341.33 g/mol |
| IUPAC name | tert-butyl N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | XSSQAAHBIVFYGC-UHFFFAOYSA-N |
| SMILES | CC1=CN(C=N1)C2=CC(=CC(=C2)NC(=O)OC(C)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)