Products 64164-08-5
CAS 64164-08-5 appears in our catalog under these names: 4-Nitroaniline-2,3,5,6-D4, >95% (HPLC), 4-Nitroaniline-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, 4–Nitroaniline–2，3，5，6–D4, D4-4-Nitroaniline. Offered by: TRC, CDN, GLPBio, HPC Standards. Available pack sizes: 1g, 250mg, 50mg, 0,25g, 0,1g, 10mg, 1x10mg.
2,3,5,6-tetradeuterio-4-nitroaniline (CAS 64164-08-5) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 142.15 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-nitroaniline. InChIKey: TYMLOMAKGOJONV-RHQRLBAQSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-nitroaniline |
| InChIKey | TYMLOMAKGOJONV-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)