CAS 64165-34-0 is the registry number for 2,4-Dimethylquinolin-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethylquinolin-6-ol (CAS 64165-34-0) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,4-dimethylquinolin-6-ol. InChIKey: HUQOZLOMZYAWGE-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,4-dimethylquinolin-6-ol |
| InChIKey | HUQOZLOMZYAWGE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=C(C=C2)O)C |
Computed by PubChem (NCBI)