CAS 64169-58-0 is the registry number for Chlorocitalopram, Hydrobromide. Offered by: TRC. Available pack sizes: 1mg.
1-(4-chlorophenyl)-1-[3-(dimethylamino)propyl]-3H-2-benzofuran-5-carbonitrile;hydrobromide (CAS 64169-58-0) is a chemical compound with the molecular formula C20H22BrClN2O and a molecular weight of 421.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-1-[3-(dimethylamino)propyl]-3H-2-benzofuran-5-carbonitrile;hydrobromide. InChIKey: UPXZASLAWCVOQT-UHFFFAOYSA-N.
| Molecular formula | C20H22BrClN2O |
|---|---|
| Molecular weight | 421.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-1-[3-(dimethylamino)propyl]-3H-2-benzofuran-5-carbonitrile;hydrobromide |
| InChIKey | UPXZASLAWCVOQT-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)Cl.Br |
Computed by PubChem (NCBI)