Products 64180-12-7

CAS 64180-12-7 is the registry number for Acenocoumarol Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4,7-dihydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]chromen-2-one (CAS 64180-12-7) is a chemical compound with the molecular formula C19H15NO7 and a molecular weight of 369.3 g/mol. IUPAC name: 4,7-dihydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]chromen-2-one. InChIKey: JTCREUDLEYTCAB-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15NO7
Molecular weight369.3 g/mol
IUPAC name4,7-dihydroxy-3-[1-(4-nitrophenyl)-3-oxobutyl]chromen-2-one
InChIKeyJTCREUDLEYTCAB-UHFFFAOYSA-N
SMILESCC(=O)CC(C1=CC=C(C=C1)[N+](=O)[O-])C2=C(C3=C(C=C(C=C3)O)OC2=O)O

Computed by PubChem (NCBI)