CAS 642-00-2 appears in our catalog under these names: (2R,3R,4R,5R)-Hexane-1,2,3,4,5,6-hexayl hexaacetate, 95+%, 1,2,3,4,5,6-Hexa-O-acetyl-D-mannitol. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g.
[(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexyl] acetate (CAS 642-00-2) is a chemical compound with the molecular formula C18H26O12 and a molecular weight of 434.4 g/mol. IUPAC name: [(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexyl] acetate. InChIKey: NJVBTKVPPOFGAT-BRSBDYLESA-N.
| Molecular formula | C18H26O12 |
|---|---|
| Molecular weight | 434.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexyl] acetate |
| InChIKey | NJVBTKVPPOFGAT-BRSBDYLESA-N |
| SMILES | CC(=O)OC[C@H]([C@H]([C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)