Products 642-59-1
CAS 642-59-1 is the registry number for Amaranth (free acid). Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid (CAS 642-59-1) is a chemical compound with the molecular formula C20H14N2O10S3 and a molecular weight of 538.5 g/mol. IUPAC name: 3-hydroxy-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid. InChIKey: IRPXADUBAQAOKL-UHFFFAOYSA-N.
| Molecular formula | C20H14N2O10S3 |
|---|---|
| Molecular weight | 538.5 g/mol |
| IUPAC name | 3-hydroxy-4-[(4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2,7-disulfonic acid |
| InChIKey | IRPXADUBAQAOKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2S(=O)(=O)O)N=NC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)