Products 64205-15-8
CAS 64205-15-8 appears in our catalog under these names: Boc-onb, 95%, Boc-ONb 98%, tert-Butyl (1，3-dioxo-3a，4，7，7a-tetrahydro-1H-4，7-methanoisoindol-2(3H)-yl) carbonate, 98%, 98%, tert-Butyl (1,3-dioxo-3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindol-2(3H)-yl) carbonate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
Tert-butyl (3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) carbonate (CAS 64205-15-8) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: tert-butyl (3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) carbonate. InChIKey: SMTQMXCDEUEZRS-UHFFFAOYSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | tert-butyl (3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl) carbonate |
| InChIKey | SMTQMXCDEUEZRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)ON1C(=O)C2C3CC(C2C1=O)C=C3 |
Computed by PubChem (NCBI)