CAS 64220-32-2 appears in our catalog under these names: 6-Chloro-3-oxo-2,3-dihydro-1H-indene-5-sulfonyl chloride, 95%, 6-Chloro-3-oxo-2,3-dihydro-1H-indene-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-chloro-3-oxo-1,2-dihydroindene-5-sulfonyl chloride (CAS 64220-32-2) is a chemical compound with the molecular formula C9H6Cl2O3S and a molecular weight of 265.11 g/mol. IUPAC name: 6-chloro-3-oxo-1,2-dihydroindene-5-sulfonyl chloride. InChIKey: TUURWJRLUXOCDV-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O3S |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 6-chloro-3-oxo-1,2-dihydroindene-5-sulfonyl chloride |
| InChIKey | TUURWJRLUXOCDV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)