CAS 6427-66-3 appears in our catalog under these names: 4-Azidobenzoic Acid, 4-Azidobenzoic Acid, >95% (HPLC), 4–Azidobenzoic Acid, 4-Azidobenzoic Acid, >97.0%(HPLC)(T), 4-AZIDOBENZOIC ACID SOLUTION. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 10g, 1g, 5g, 100g, 25g, 50g, 250g.
4-azidobenzoic acid (CAS 6427-66-3) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 4-azidobenzoic acid. InChIKey: PQXPAFTXDVNANI-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-azidobenzoic acid |
| InChIKey | PQXPAFTXDVNANI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)