CAS 643-84-5 appears in our catalog under these names: Malvidin (chloride), Malvidin Chloride, MALVIDIN CHLORIDE, >=95.0% HPLC, Malvidin (chloride), 98.48%, Malvidin chlorid. Offered by: GLPBio, TRC, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 2mg, 25mg, 5 mg, 10 mg, 1x10mg.
2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3,5,7-triol chloride (CAS 643-84-5) is a chemical compound with the molecular formula C17H15ClO7 and a molecular weight of 366.7 g/mol. IUPAC name: 2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3,5,7-triol chloride. InChIKey: KQIKOUUKQBTQBE-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO7 |
|---|---|
| Molecular weight | 366.7 g/mol |
| IUPAC name | 2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3,5,7-triol chloride |
| InChIKey | KQIKOUUKQBTQBE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O.[Cl-] |
Computed by PubChem (NCBI)