CAS 64309-05-3 appears in our catalog under these names: 6–(4–Azido–2–nitrophenylamino)hexanoic acid N–hydroxysuccinimide ester, SANPAH, >95.0%(HPLC), Hexanoic acid,6-[(4-azido-2-nitrophenyl)amino]-, 2,5-dioxo-1-pyrrolidinyl ester, 95.0%, 95.0%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 50mg, 25mg, 100mg.
(2,5-dioxopyrrolidin-1-yl) 6-(4-azido-2-nitroanilino)hexanoate (CAS 64309-05-3) is a chemical compound with the molecular formula C16H18N6O6 and a molecular weight of 390.35 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-(4-azido-2-nitroanilino)hexanoate. InChIKey: NGXDNMNOQDVTRL-UHFFFAOYSA-N.
| Molecular formula | C16H18N6O6 |
|---|---|
| Molecular weight | 390.35 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-(4-azido-2-nitroanilino)hexanoate |
| InChIKey | NGXDNMNOQDVTRL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCNC2=C(C=C(C=C2)N=[N+]=[N-])[N+](=O)[O-] |
Computed by PubChem (NCBI)