CAS 6431-65-8 appears in our catalog under these names: 6-(Trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine, 95%, 6-(Trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine (CAS 6431-65-8) is a chemical compound with the molecular formula C9H8F3NS and a molecular weight of 219.23 g/mol. IUPAC name: 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine. InChIKey: MEJJCPDHJCPHMO-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NS |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| InChIKey | MEJJCPDHJCPHMO-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(N1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)