Products 64339-18-0
CAS 64339-18-0 appears in our catalog under these names: Rhodamine 101 (chloride), 95.0%, Rhodamine 101, 97%, 97%, Rhodamine 101 chloride, 97%. Offered by: MedChemExpress, Chemat, Ambeed. Available pack sizes: 5 mg, 100 mg, 10 mg, 50 mg, 25 mg, 5mg, 25mg, 100mg.
2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoic acid chloride (CAS 64339-18-0) is a chemical compound with the molecular formula C32H31ClN2O3 and a molecular weight of 527.0 g/mol. IUPAC name: 2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoic acid chloride. InChIKey: ANORACDFPHMJSX-UHFFFAOYSA-N.
| Molecular formula | C32H31ClN2O3 |
|---|---|
| Molecular weight | 527.0 g/mol |
| IUPAC name | 2-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)benzoic acid chloride |
| InChIKey | ANORACDFPHMJSX-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C4=C2N(C1)CCC4)OC5=C6CCC[N+]7=C6C(=CC5=C3C8=CC=CC=C8C(=O)O)CCC7.[Cl-] |
Computed by PubChem (NCBI)