CAS 64339-39-5 is the registry number for Mono(2-hydroxyisobutyl)phthalate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-(2-hydroxy-2-methylpropoxy)carbonylbenzoate (CAS 64339-39-5) is a chemical compound with the molecular formula C12H13O5- and a molecular weight of 237.23 g/mol. IUPAC name: 2-(2-hydroxy-2-methylpropoxy)carbonylbenzoate. InChIKey: LTLINVWNJJAVGH-UHFFFAOYSA-M.
| Molecular formula | C12H13O5- |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 2-(2-hydroxy-2-methylpropoxy)carbonylbenzoate |
| InChIKey | LTLINVWNJJAVGH-UHFFFAOYSA-M |
| SMILES | CC(C)(COC(=O)C1=CC=CC=C1C(=O)[O-])O |
Computed by PubChem (NCBI)