CAS 64346-00-5 appears in our catalog under these names: 5,5'–Sulfonyldiisophthalic acid, 5,5'-Sulfonyldiisophthalic acid, 95%, 95%, 5,5'-Sulfonyldiisophthalic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-(3,5-dicarboxyphenyl)sulfonylbenzene-1,3-dicarboxylic acid (CAS 64346-00-5) is a chemical compound with the molecular formula C16H10O10S and a molecular weight of 394.3 g/mol. IUPAC name: 5-(3,5-dicarboxyphenyl)sulfonylbenzene-1,3-dicarboxylic acid. InChIKey: ZGHBAQRKLOAGMG-UHFFFAOYSA-N.
| Molecular formula | C16H10O10S |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | 5-(3,5-dicarboxyphenyl)sulfonylbenzene-1,3-dicarboxylic acid |
| InChIKey | ZGHBAQRKLOAGMG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)S(=O)(=O)C2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)