CAS 64354-26-3 is the registry number for 4,6-Dibromo-5-hydroxypicolinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 25g, 10g.
4,6-dibromo-5-hydroxypyridine-2-carboxylic acid (CAS 64354-26-3) is a chemical compound with the molecular formula C6H3Br2NO3 and a molecular weight of 296.90 g/mol. IUPAC name: 4,6-dibromo-5-hydroxypyridine-2-carboxylic acid. InChIKey: KAQSHVQNOSITQB-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO3 |
|---|---|
| Molecular weight | 296.90 g/mol |
| IUPAC name | 4,6-dibromo-5-hydroxypyridine-2-carboxylic acid |
| InChIKey | KAQSHVQNOSITQB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1C(=O)O)Br)O)Br |
Computed by PubChem (NCBI)