Products 64354-26-3

CAS 64354-26-3 is the registry number for 4,6-Dibromo-5-hydroxypicolinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 25g, 10g.

Structural formula: {0} (CAS {1})

4,6-dibromo-5-hydroxypyridine-2-carboxylic acid (CAS 64354-26-3) is a chemical compound with the molecular formula C6H3Br2NO3 and a molecular weight of 296.90 g/mol. IUPAC name: 4,6-dibromo-5-hydroxypyridine-2-carboxylic acid. InChIKey: KAQSHVQNOSITQB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Br2NO3
Molecular weight296.90 g/mol
IUPAC name4,6-dibromo-5-hydroxypyridine-2-carboxylic acid
InChIKeyKAQSHVQNOSITQB-UHFFFAOYSA-N
SMILESC1=C(C(=C(N=C1C(=O)O)Br)O)Br

Computed by PubChem (NCBI)