CAS 64363-96-8 appears in our catalog under these names: trans-Deltamethrin, trans-Deltamethrin 100 µg/mL in Acetonitrile, trans-Deltamethrin, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 1mg, 2,5mg, 25mg, 1ml, 5mg, 10mg, 50mg, 1x1ml.
Cis-[(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 64363-96-8) is a chemical compound with the molecular formula C22H19Br2NO3 and a molecular weight of 505.2 g/mol. IUPAC name: cis-[(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: OWZREIFADZCYQD-GGPKGHCWSA-N.
| Molecular formula | C22H19Br2NO3 |
|---|---|
| Molecular weight | 505.2 g/mol |
| IUPAC name | cis-[(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | OWZREIFADZCYQD-GGPKGHCWSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)O[C@H](C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Br)Br)C |
Computed by PubChem (NCBI)