CAS 64365-27-1 appears in our catalog under these names: Ac–Arg–NH₂, Ac-Arg-NH2. Offered by: GLPBio, Creative Peptides. Available pack sizes: 1g, 5g.
(2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide (CAS 64365-27-1) is a chemical compound with the molecular formula C8H17N5O2 and a molecular weight of 215.25 g/mol. IUPAC name: (2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide. InChIKey: ZWAIIHKSWHGLFY-LURJTMIESA-N.
| Molecular formula | C8H17N5O2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide |
| InChIKey | ZWAIIHKSWHGLFY-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
Computed by PubChem (NCBI)