Products 643725-89-7
CAS 643725-89-7 is the registry number for {(4-(4-tert-Butylphenyl)-1,3-thiazol-2-yl)methyl}(methyl)amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-N-methylmethanamine (CAS 643725-89-7) is a chemical compound with the molecular formula C15H20N2S and a molecular weight of 260.4 g/mol. IUPAC name: 1-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-N-methylmethanamine. InChIKey: DCHDQMOAKLRKST-UHFFFAOYSA-N.
| Molecular formula | C15H20N2S |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 1-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-N-methylmethanamine |
| InChIKey | DCHDQMOAKLRKST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CSC(=N2)CNC |
Computed by PubChem (NCBI)