CAS 64373-51-9 is the registry number for 5-Formylfuran-2-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-formylfuran-2-sulfonic acid (CAS 64373-51-9) is a chemical compound with the molecular formula C5H4O5S and a molecular weight of 176.15 g/mol. IUPAC name: 5-formylfuran-2-sulfonic acid. InChIKey: URIMPWMBVPNFDM-UHFFFAOYSA-N.
| Molecular formula | C5H4O5S |
|---|---|
| Molecular weight | 176.15 g/mol |
| IUPAC name | 5-formylfuran-2-sulfonic acid |
| InChIKey | URIMPWMBVPNFDM-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)S(=O)(=O)O)C=O |
Computed by PubChem (NCBI)