Products 64373-51-9

CAS 64373-51-9 is the registry number for 5-Formylfuran-2-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-formylfuran-2-sulfonic acid (CAS 64373-51-9) is a chemical compound with the molecular formula C5H4O5S and a molecular weight of 176.15 g/mol. IUPAC name: 5-formylfuran-2-sulfonic acid. InChIKey: URIMPWMBVPNFDM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4O5S
Molecular weight176.15 g/mol
IUPAC name5-formylfuran-2-sulfonic acid
InChIKeyURIMPWMBVPNFDM-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)S(=O)(=O)O)C=O

Computed by PubChem (NCBI)