CAS 64378-95-6 is the registry number for Oxyfluorfen Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-ethoxyaniline (CAS 64378-95-6) is a chemical compound with the molecular formula C15H13ClF3NO2 and a molecular weight of 331.72 g/mol. IUPAC name: 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-ethoxyaniline. InChIKey: DACJMMUOMVCDEV-UHFFFAOYSA-N.
| Molecular formula | C15H13ClF3NO2 |
|---|---|
| Molecular weight | 331.72 g/mol |
| IUPAC name | 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-ethoxyaniline |
| InChIKey | DACJMMUOMVCDEV-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)OC2=C(C=C(C=C2)C(F)(F)F)Cl)N |
Computed by PubChem (NCBI)