CAS 64396-09-4 is the registry number for Terfluranol. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2R,3S)-5,5,5-trifluoro-3-(4-hydroxyphenyl)pentan-2-yl]phenol (CAS 64396-09-4) is a chemical compound with the molecular formula C17H17F3O2 and a molecular weight of 310.31 g/mol. IUPAC name: 4-[(2R,3S)-5,5,5-trifluoro-3-(4-hydroxyphenyl)pentan-2-yl]phenol. InChIKey: KTUJPJJUMKZGCV-ZBEGNZNMSA-N.
| Molecular formula | C17H17F3O2 |
|---|---|
| Molecular weight | 310.31 g/mol |
| IUPAC name | 4-[(2R,3S)-5,5,5-trifluoro-3-(4-hydroxyphenyl)pentan-2-yl]phenol |
| InChIKey | KTUJPJJUMKZGCV-ZBEGNZNMSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)O)[C@H](CC(F)(F)F)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)