CAS 6441-93-6 appears in our catalog under these names: Acid Red 35, C.I.Acid Red 35. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 250mg, 100 mg, 25 mg, 5 mg.
Disodium;5-acetamido-4-hydroxy-3-[(2-methylphenyl)diazenyl]naphthalene-2,7-disulfonate (CAS 6441-93-6) is a chemical compound with the molecular formula C19H15N3Na2O8S2 and a molecular weight of 523.5 g/mol. IUPAC name: disodium;5-acetamido-4-hydroxy-3-[(2-methylphenyl)diazenyl]naphthalene-2,7-disulfonate. InChIKey: LGWXIBBJZQOXSO-UHFFFAOYSA-L.
| Molecular formula | C19H15N3Na2O8S2 |
|---|---|
| Molecular weight | 523.5 g/mol |
| IUPAC name | disodium;5-acetamido-4-hydroxy-3-[(2-methylphenyl)diazenyl]naphthalene-2,7-disulfonate |
| InChIKey | LGWXIBBJZQOXSO-UHFFFAOYSA-L |
| SMILES | CC1=CC=CC=C1N=NC2=C(C3=C(C=C(C=C3C=C2S(=O)(=O)[O-])S(=O)(=O)[O-])NC(=O)C)O.[Na+].[Na+] |
Computed by PubChem (NCBI)