CAS 64420-99-1 is the registry number for 2-Aminobiphenyl-2’,3’,4’,5’,6’-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-(2,3,4,5,6-pentadeuteriophenyl)aniline (CAS 64420-99-1) is a chemical compound with the molecular formula C12H11N and a molecular weight of 174.25 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriophenyl)aniline. InChIKey: TWBPWBPGNQWFSJ-FSTBWYLISA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 174.25 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| InChIKey | TWBPWBPGNQWFSJ-FSTBWYLISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=CC=C2N)[2H])[2H] |
Computed by PubChem (NCBI)