CAS 64461-98-9 is the registry number for 1,2,4,6,7,8-Hexachlorodibenzodioxin. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,6,7,9-hexachlorodibenzo-p-dioxin (CAS 64461-98-9) is a chemical compound with the molecular formula C12H2Cl6O2 and a molecular weight of 390.9 g/mol. IUPAC name: 1,2,3,6,7,9-hexachlorodibenzo-p-dioxin. InChIKey: BQOHWGKNRKCEFT-UHFFFAOYSA-N.
| Molecular formula | C12H2Cl6O2 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | 1,2,3,6,7,9-hexachlorodibenzo-p-dioxin |
| InChIKey | BQOHWGKNRKCEFT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Cl)Cl)Cl)OC3=C(O2)C(=C(C=C3Cl)Cl)Cl |
Computed by PubChem (NCBI)