CAS 64480-68-8 is the registry number for Riboflavin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]quinoxaline-2-carboxylic acid (CAS 64480-68-8) is a chemical compound with the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. IUPAC name: 6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]quinoxaline-2-carboxylic acid. InChIKey: HASRQDXCKZETLY-SCRDCRAPSA-N.
| Molecular formula | C16H20N2O7 |
|---|---|
| Molecular weight | 352.34 g/mol |
| IUPAC name | 6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]quinoxaline-2-carboxylic acid |
| InChIKey | HASRQDXCKZETLY-SCRDCRAPSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C(=O)C(=N2)C(=O)O)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)