CAS 64485-89-8 is the registry number for Cefotaxime Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate (CAS 64485-89-8) is a chemical compound with the molecular formula C27H25N3O3S and a molecular weight of 471.6 g/mol. IUPAC name: ethyl (2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate. InChIKey: HZUYVNWQSAISMN-KRUMMXJUSA-N.
| Molecular formula | C27H25N3O3S |
|---|---|
| Molecular weight | 471.6 g/mol |
| IUPAC name | ethyl (2Z)-2-methoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
| InChIKey | HZUYVNWQSAISMN-KRUMMXJUSA-N |
| SMILES | CCOC(=O)/C(=N\OC)/C1=CSC(=N1)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)