CAS 644959-94-4 appears in our catalog under these names: 6-(Chloromethyl)-n-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine, 95%, 6-(Chloromethyl)-N2-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g, 5g.
6-(chloromethyl)-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine (CAS 644959-94-4) is a chemical compound with the molecular formula C10H8Cl3N5 and a molecular weight of 304.6 g/mol. IUPAC name: 6-(chloromethyl)-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: BVXIQAHVNCQTQC-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl3N5 |
|---|---|
| Molecular weight | 304.6 g/mol |
| IUPAC name | 6-(chloromethyl)-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | BVXIQAHVNCQTQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC(=NC(=N2)N)CCl)Cl)Cl |
Computed by PubChem (NCBI)