Products 644969-37-9
CAS 644969-37-9 is the registry number for 1'-Benzyl-5-chloro-3H-spiro[isobenzofuran-1,4'-piperidin]-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1'-benzyl-6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one (CAS 644969-37-9) is a chemical compound with the molecular formula C19H18ClNO2 and a molecular weight of 327.8 g/mol. IUPAC name: 1'-benzyl-6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one. InChIKey: VPIMKFBEIYHOIS-UHFFFAOYSA-N.
| Molecular formula | C19H18ClNO2 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | 1'-benzyl-6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one |
| InChIKey | VPIMKFBEIYHOIS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12C3=C(C=C(C=C3)Cl)C(=O)O2)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)