CAS 645-12-5 appears in our catalog under these names: 5–Nitro–2–furancarboxylic Acid, 5-Nitro-2-furoic acid, 98%, 5-Nitro-2-furoic acid, 98+% , 5-Nitrofuran-2-carboxylic acid 95%, 5-Nitrofuran-2-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 1g, 10g, on request, 250mg.
5-nitrofuran-2-carboxylic acid (CAS 645-12-5) is a chemical compound with the molecular formula C5H3NO5 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitrofuran-2-carboxylic acid. InChIKey: IODMEDPPCXSFLD-UHFFFAOYSA-N.
| Molecular formula | C5H3NO5 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitrofuran-2-carboxylic acid |
| InChIKey | IODMEDPPCXSFLD-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)