CAS 64531-29-9 is the registry number for Benzimidazole-4,5,6,7-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
4,5,6,7-tetradeuterio-1H-benzimidazole (CAS 64531-29-9) is a chemical compound with the molecular formula C7H6N2 and a molecular weight of 122.16 g/mol. IUPAC name: 4,5,6,7-tetradeuterio-1H-benzimidazole. InChIKey: HYZJCKYKOHLVJF-RHQRLBAQSA-N.
| Molecular formula | C7H6N2 |
|---|---|
| Molecular weight | 122.16 g/mol |
| IUPAC name | 4,5,6,7-tetradeuterio-1H-benzimidazole |
| InChIKey | HYZJCKYKOHLVJF-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])NC=N2)[2H])[2H] |
Computed by PubChem (NCBI)