Products 64531-29-9

CAS 64531-29-9 is the registry number for Benzimidazole-4,5,6,7-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

4,5,6,7-tetradeuterio-1H-benzimidazole (CAS 64531-29-9) is a chemical compound with the molecular formula C7H6N2 and a molecular weight of 122.16 g/mol. IUPAC name: 4,5,6,7-tetradeuterio-1H-benzimidazole. InChIKey: HYZJCKYKOHLVJF-RHQRLBAQSA-N.

Identity
Molecular formulaC7H6N2
Molecular weight122.16 g/mol
IUPAC name4,5,6,7-tetradeuterio-1H-benzimidazole
InChIKeyHYZJCKYKOHLVJF-RHQRLBAQSA-N
SMILES[2H]C1=C(C(=C2C(=C1[2H])NC=N2)[2H])[2H]

Computed by PubChem (NCBI)