CAS 64546-10-7 appears in our catalog under these names: α-Hydroxyetizolam, >95% (HPLC), α–hydroxy Etizolam, α-Hydroxy etizolam. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 1mg, 1 mg, 500 μg.
1-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethanol (CAS 64546-10-7) is a chemical compound with the molecular formula C17H15ClN4OS and a molecular weight of 358.8 g/mol. IUPAC name: 1-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethanol. InChIKey: YRJXUAYHZCDGDO-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN4OS |
|---|---|
| Molecular weight | 358.8 g/mol |
| IUPAC name | 1-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethanol |
| InChIKey | YRJXUAYHZCDGDO-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(S3)C(C)O)C(=NC2)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)