CAS 64573-23-5 is the registry number for 4-(2,3-Dihydro-1H-perimidin-2-yl)phenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
4-(2,3-dihydro-1H-perimidin-2-yl)phenol (CAS 64573-23-5) is a chemical compound with the molecular formula C17H14N2O and a molecular weight of 262.30 g/mol. IUPAC name: 4-(2,3-dihydro-1H-perimidin-2-yl)phenol. InChIKey: FADYQKSIESMOII-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 4-(2,3-dihydro-1H-perimidin-2-yl)phenol |
| InChIKey | FADYQKSIESMOII-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NC(NC3=CC=C2)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)