CAS 646-83-3 is the registry number for Perfluoro-p-ethylcyclohexylsulfonic acid. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonic acid (CAS 646-83-3) is a chemical compound with the molecular formula C8HF15O3S and a molecular weight of 462.13 g/mol. IUPAC name: 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonic acid. InChIKey: ICKAEAFPESRWOT-UHFFFAOYSA-N.
| Molecular formula | C8HF15O3S |
|---|---|
| Molecular weight | 462.13 g/mol |
| IUPAC name | 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonic acid |
| InChIKey | ICKAEAFPESRWOT-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1(F)F)(F)F)(F)S(=O)(=O)O)(F)F)(F)F)(C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)