CAS 6461-99-0 is the registry number for 4,4'-Dicyanodiphenylsulphone. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg.
4-(4-cyanophenyl)sulfonylbenzonitrile (CAS 6461-99-0) is a chemical compound with the molecular formula C14H8N2O2S and a molecular weight of 268.29 g/mol. IUPAC name: 4-(4-cyanophenyl)sulfonylbenzonitrile. InChIKey: MZKBKRFSDLTYAN-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O2S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | 4-(4-cyanophenyl)sulfonylbenzonitrile |
| InChIKey | MZKBKRFSDLTYAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)S(=O)(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)