Products 646450-23-9
CAS 646450-23-9 is the registry number for (Rac)-Luciferin 6′-methyl ether (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 2-(6-methoxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CAS 646450-23-9) is a chemical compound with the molecular formula C12H9N2NaO3S2 and a molecular weight of 316.3 g/mol. IUPAC name: sodium 2-(6-methoxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate. InChIKey: JVIWMVSTNAQLLC-UHFFFAOYSA-M.
| Molecular formula | C12H9N2NaO3S2 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | sodium 2-(6-methoxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| InChIKey | JVIWMVSTNAQLLC-UHFFFAOYSA-M |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)C3=NC(CS3)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)