CAS 646459-45-2 is the registry number for Etoricoxib Impurity J. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-(4-ethylsulfonylphenyl)-2-(6-methyl-3-pyridinyl)pyridine (CAS 646459-45-2) is a chemical compound with the molecular formula C19H17ClN2O2S and a molecular weight of 372.9 g/mol. IUPAC name: 5-chloro-3-(4-ethylsulfonylphenyl)-2-(6-methyl-3-pyridinyl)pyridine. InChIKey: YEHBBVXKTFWRJH-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O2S |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | 5-chloro-3-(4-ethylsulfonylphenyl)-2-(6-methyl-3-pyridinyl)pyridine |
| InChIKey | YEHBBVXKTFWRJH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=C(C=C1)C2=C(N=CC(=C2)Cl)C3=CN=C(C=C3)C |
Computed by PubChem (NCBI)