CAS 646497-42-9 is the registry number for N-(3,5-Bis(trifluoromethyl)phenyl)-2-bromopropanamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[3,5-bis(trifluoromethyl)phenyl]-2-bromopropanamide (CAS 646497-42-9) is a chemical compound with the molecular formula C11H8BrF6NO and a molecular weight of 364.08 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]-2-bromopropanamide. InChIKey: PCESRJVCFUAIBU-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF6NO |
|---|---|
| Molecular weight | 364.08 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]-2-bromopropanamide |
| InChIKey | PCESRJVCFUAIBU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)Br |
Computed by PubChem (NCBI)